C22H19ClF3N5O — CID 118949797
[2-chloro-3-(trifluoromethyl)phenyl]-[6-(1H-imidazol-2-yl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone (PubChem CID 118949797) has the molecular formula C22H19ClF3N5O and a molecular weight of 461.88 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[6-(1H-imidazol-2-yl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[6-(1H-imidazol-2-yl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
|---|---|
| PubChem CID | 118949797 |
| Molecular Formula | C22H19ClF3N5O |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[6-(1H-imidazol-2-yl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
| SMILES | Cc1nc(-c2ncc[nH]2)c2c(n1)C1CCCC(C2)N1C(=O)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C22H19ClF3N5O/c1-11-29-18-14(19(30-11)20-27-8-9-28-20)10-12-4-2-7-16(18)31(12)21(32)13-5-3-6-15(17(13)23)22(24,25)26/h3,5-6,8-9,12,16H,2,4,7,10H2,1H3,(H,27,28) |
| InChIKey | UWCVMRIYPVGXIW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |