C24H20ClF2N3O — CID 118949310
(2-chloro-4-fluorophenyl)-[(1S,9R)-6-(4-fluorophenyl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone (PubChem CID 118949310) has the molecular formula C24H20ClF2N3O and a molecular weight of 439.89 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[(1S,9R)-6-(4-fluorophenyl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[(1S,9R)-6-(4-fluorophenyl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
|---|---|
| PubChem CID | 118949310 |
| Molecular Formula | C24H20ClF2N3O |
| Molecular Weight | 439.89 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[(1S,9R)-6-(4-fluorophenyl)-4-methyl-3,5,13-triazatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]methanone |
| SMILES | Cc1nc(-c2ccc(F)cc2)c2c(n1)[C@@H]1CCC[C@H](C2)N1C(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H20ClF2N3O/c1-13-28-22(14-5-7-15(26)8-6-14)19-12-17-3-2-4-21(23(19)29-13)30(17)24(31)18-10-9-16(27)11-20(18)25/h5-11,17,21H,2-4,12H2,1H3/t17-,21+/m1/s1 |
| InChIKey | KHKXDBHKIYUSNX-UTKZUKDTSA-N |
| XLogP | 5.68 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.89 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |