C19H14N8O — CID 137398382
4-N-[4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazoline-4,6-diamine (PubChem CID 137398382) has the molecular formula C19H14N8O and a molecular weight of 370.38 g/mol. Its IUPAC name is 4-N-[4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 137398382 |
| Molecular Formula | C19H14N8O |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-N-[4-([1,2,4]triazolo[1,5-c]pyrimidin-7-yloxy)phenyl]quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccc(Oc4cc5ncnn5cn4)cc3)c2c1 |
| InChI | InChI=1S/C19H14N8O/c20-12-1-6-16-15(7-12)19(23-9-21-16)26-13-2-4-14(5-3-13)28-18-8-17-22-10-25-27(17)11-24-18/h1-11H,20H2,(H,21,23,26) |
| InChIKey | SFLUMXDUDZTIJS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|