C20H15N7O — CID 137398088
4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinazoline-4,6-diamine (PubChem CID 137398088) has the molecular formula C20H15N7O and a molecular weight of 369.39 g/mol. Its IUPAC name is 4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 137398088 |
| Molecular Formula | C20H15N7O |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccc(Oc4cc5nccn5cn4)cc3)c2c1 |
| InChI | InChI=1S/C20H15N7O/c21-13-1-6-17-16(9-13)20(24-11-23-17)26-14-2-4-15(5-3-14)28-19-10-18-22-7-8-27(18)12-25-19/h1-12H,21H2,(H,23,24,26) |
| InChIKey | SKSGRYIGXZOXIN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|