About 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine
3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine (PubChem CID 145360439) has the molecular formula C23H20N6O
and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine.
Molecular Properties
| Compound Name | 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine |
| PubChem CID | 145360439 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine |
| SMILES | CCc1cnc2ccc(N)cc2c1Nc1ccc(Oc2cc3nccn3cn2)cc1 |
| InChI | InChI=1S/C23H20N6O/c1-2-15-13-26-20-8-3-16(24)11-19(20)23(15)28-17-4-6-18(7-5-17)30-22-12-21-25-9-10-29(21)14-27-22/h3-14H,2,24H2,1H3,(H,26,28) |
| InChIKey | ZRIRCQZQUVYKSW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine?
The IUPAC name of 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine (CID 145360439) is 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine.
What is the SMILES notation for 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine?
The canonical SMILES for 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine is CCc1cnc2ccc(N)cc2c1Nc1ccc(Oc2cc3nccn3cn2)cc1.
What is the InChIKey of 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine?
The InChIKey is ZRIRCQZQUVYKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N6O/c1-2-15-13-26-20-8-3-16(24)11-19(20)23(15)28-17-4-6-18(7-5-17)30-22-12-21-25-9-10-29(21)14-27-22/h3-14H,2,24H2,1H3,(H,26,28).
What are the key properties of 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine?
3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine has a molecular weight of 396.45 g/mol, XLogP of 4.96, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-N-(4-imidazo[1,2-c]pyrimidin-7-yloxyphenyl)quinoline-4,6-diamine is sourced from PubChem (CID 145360439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).