C60H86O20 — CID 137401729
CID 137401729 (PubChem CID 137401729) has the molecular formula C60H86O20 and a molecular weight of 1127.33 g/mol.
| Compound Name | CID 137401729 |
|---|---|
| PubChem CID | 137401729 |
| Molecular Formula | C60H86O20 |
| Molecular Weight | 1127.33 g/mol |
| Exact Mass | 1126.57 |
| IUPAC Name | — |
| SMILES | C=C1CC2CC[C@]34C[C@@](O)(OC)C(O3)C3CC(O4)[C@H]4OC(CCC4O3)CC(=O)OC3[C@H](CC4OC(CCC1O2)C[C@@H](C)C4=C)O[C@H]1C[C@H]2O[C@@]4(CC5O[C@@]6(C[C@H](C)C5O4)C[C@H](C)C4OC(CC(=O)O)[C@H](O)C[C@@H]4O6)C[C@H]2O[C@H]1[C@@H]3C |
| InChI | InChI=1S/C60H86O20/c1-27-14-33-8-10-37-28(2)15-35(67-37)12-13-57-26-60(65,66-7)56(80-57)46-20-45(76-57)55-38(70-46)11-9-34(69-55)16-50(64)74-54-32(6)53-43(71-42(54)18-39(68-33)31(27)5)19-41-47(73-53)24-59(75-41)25-48-52(79-59)30(4)23-58(78-48)22-29(3)51-44(77-58)17-36(61)40(72-51)21-49(62)63/h27,29-30,32-48,51-56,61,65H,2,5,8-26H2,1,3-4,6-7H3,(H,62,63)/t27-,29+,30+,32+,33?,34?,35?,36-,37?,38?,39?,40?,41-,42+,43+,44+,45?,46?,47-,48?,51?,52?,53+,54?,55+,56?,57-,58-,59+,60-/m1/s1 |
| InChIKey | GOJQAKQQAFENHE-SCZJXKPCSA-N |
| XLogP | 5.61 |
| TPSA | 233.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1127.33 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|