C58H83NO17 — CID 155907622
E-7130 (PubChem CID 155907622) has the molecular formula C58H83NO17 and a molecular weight of 1066.29 g/mol.
| Compound Name | E-7130 |
|---|---|
| PubChem CID | 155907622 |
| Molecular Formula | C58H83NO17 |
| Molecular Weight | 1066.29 g/mol |
| Exact Mass | 1065.57 |
| IUPAC Name | — |
| SMILES | C=C1C[C@H]2CC[C@@]34C[C@H]5O[C@H]6[C@@H](O3)[C@@H]3O[C@H](CC[C@H]3O[C@@H]6[C@@H]5O4)CC(=O)O[C@@H]3[C@@H](C)[C@@H]4O[C@@H]5C[C@]6(C[C@@H]7O[C@]8(C[C@@H](C)[C@H]7O6)C[C@H](C)[C@@H]6O[C@H](CN)[C@@H](O)C[C@H]6O8)O[C@@H]5C[C@H]4O[C@H]3C[C@@H]3O[C@@H](CC[C@@H]1O2)C[C@H](C)C3=C |
| InChI | InChI=1S/C58H83NO17/c1-25-13-31-7-9-35-26(2)14-33(62-35)11-12-56-22-43-52(75-56)53-54(68-43)55(76-56)51-36(66-53)10-8-32(64-51)15-46(61)70-50-30(6)49-40(65-39(50)17-37(63-31)29(25)5)18-38-42(67-49)21-58(71-38)23-44-48(74-58)28(4)20-57(73-44)19-27(3)47-41(72-57)16-34(60)45(24-59)69-47/h25,27-28,30-45,47-55,60H,2,5,7-24,59H2,1,3-4,6H3/t25-,27-,28+,30-,31-,32+,33+,34-,35-,36+,37-,38+,39-,40+,41+,42+,43+,44-,45+,47-,48+,49-,50+,51+,52+,53+,54+,55-,56-,57-,58-/m0/s1 |
| InChIKey | MJMBDBINYFNDST-VPWQYRPWSA-N |
| XLogP | 5.14 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|