C60H86O17 — CID 158379764
CID 158379764 (PubChem CID 158379764) has the molecular formula C60H86O17 and a molecular weight of 1079.33 g/mol.
| Compound Name | CID 158379764 |
|---|---|
| PubChem CID | 158379764 |
| Molecular Formula | C60H86O17 |
| Molecular Weight | 1079.33 g/mol |
| Exact Mass | 1078.59 |
| IUPAC Name | — |
| SMILES | C=C1CC2CCC34CC5OC6C(OC7CCC(CC(=O)OC8C(CC9OC(CCC1O2)CC(C)C9=C)OC1CC2OC9(CC2OC1C8C)CC1OC2(CC(C)C8OC(CCC)C(O)CC8O2)CC(C)C1O9)OC7C6O3)C5O4 |
| InChI | InChI=1S/C60H86O17/c1-8-9-38-36(61)19-44-49(67-38)29(4)22-59(73-44)23-30(5)50-47(74-59)26-60(75-50)24-45-41(72-60)21-43-51(69-45)32(7)52-42(66-43)20-40-31(6)27(2)16-33(64-40)10-12-37-28(3)17-35(63-37)14-15-58-25-46-54(76-58)55-56(70-46)57(77-58)53-39(68-55)13-11-34(65-53)18-48(62)71-52/h27,29-30,32-47,49-57,61H,3,6,8-26H2,1-2,4-5,7H3 |
| InChIKey | GWPUUGVXIYIYGL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.33 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|