C58H84O17 — CID 167263649
CID 167263649 (PubChem CID 167263649) has the molecular formula C58H84O17 and a molecular weight of 1053.29 g/mol.
| Compound Name | CID 167263649 |
|---|---|
| PubChem CID | 167263649 |
| Molecular Formula | C58H84O17 |
| Molecular Weight | 1053.29 g/mol |
| Exact Mass | 1052.57 |
| IUPAC Name | — |
| SMILES | C=C1C2CC3O[C@H]4C[C@H]5O[C@@]6(CC7O[C@@]8(C[C@H](C)C7O6)C[C@H](C)[C@@H]6OC(CO)[C@H](O)C[C@@H]6O8)C[C@H]5O[C@H]4[C@H](C)[C@H]3OC(=O)CC3CC[C@@H]4O[C@@H]5C[C@@H](O[C@@]6(CCC7CC(=C)[C@H](CCC(C[C@H]1C)O2)O7)CCC5O6)[C@H]4O3 |
| InChI | InChI=1S/C58H84O17/c1-27-15-33-7-9-37-28(2)16-35(62-37)11-13-56-14-12-38(70-56)41-20-46(72-56)55-39(65-41)10-8-34(64-55)17-50(61)69-54-32(6)53-44(66-43(54)19-40(63-33)31(27)5)21-42-47(67-53)24-58(71-42)25-48-52(75-58)30(4)23-57(74-48)22-29(3)51-45(73-57)18-36(60)49(26-59)68-51/h27,29-30,32-49,51-55,59-60H,2,5,7-26H2,1,3-4,6H3/t27-,29+,30+,32+,33?,34?,35?,36-,37+,38?,39+,40?,41-,42-,43?,44+,45+,46-,47-,48?,49?,51+,52?,53+,54-,55+,56+,57-,58+/m1/s1 |
| InChIKey | KUFDFCSBKXXJJL-MLGQYVQBSA-N |
| XLogP | 6.19 |
| TPSA | 186.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1053.29 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|