C58H81N3O16 — CID 167263936
CID 167263936 (PubChem CID 167263936) has the molecular formula C58H81N3O16 and a molecular weight of 1076.29 g/mol.
| Compound Name | CID 167263936 |
|---|---|
| PubChem CID | 167263936 |
| Molecular Formula | C58H81N3O16 |
| Molecular Weight | 1076.29 g/mol |
| Exact Mass | 1075.56 |
| IUPAC Name | — |
| SMILES | C=C1C2C[C@@H]3O[C@H]4C[C@H]5O[C@@]6(CC7O[C@]8(C[C@H](C)C9O[C@H](CN=[N+]=[N-])[C@H](O)CC9O8)C[C@H](C)C7O6)C[C@H]5O[C@H]4[C@H](C)[C@H]3OC(=O)CC3CC[C@@H]4O[C@@H]5C[C@@H](O[C@@]6(C/C=C7/CC(=C)[C@H](CC[C@@H](C[C@H]1C)O2)O7)CC[C@@H]5O6)[C@H]4O3 |
| InChI | InChI=1S/C58H81N3O16/c1-27-15-33-7-9-37-28(2)16-35(64-37)11-13-56-14-12-38(72-56)41-20-46(74-56)55-39(67-41)10-8-34(66-55)17-50(63)71-54-32(6)53-44(68-43(54)19-40(65-33)31(27)5)21-42-47(69-53)24-58(73-42)25-48-52(77-58)30(4)23-57(76-48)22-29(3)51-45(75-57)18-36(62)49(70-51)26-60-61-59/h11,27,29-30,32-34,36-49,51-55,62H,2,5,7-10,12-26H2,1,3-4,6H3/b35-11-/t27-,29+,30+,32+,33+,34?,36-,37+,38+,39+,40?,41-,42-,43+,44+,45?,46-,47-,48?,49-,51?,52?,53+,54-,55+,56+,57-,58+/m1/s1 |
| InChIKey | AKKODXNNLLCEHU-MQUOSKHUSA-N |
| XLogP | 7.63 |
| TPSA | 215.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1076.29 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|