C23H26N2O13S — CID 137402586
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-imidazol-1-ylsulfonyloxyphenoxy)oxan-2-yl]methyl acetate (PubChem CID 137402586) has the molecular formula C23H26N2O13S and a molecular weight of 570.53 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-imidazol-1-ylsulfonyloxyphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-imidazol-1-ylsulfonyloxyphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 137402586 |
| Molecular Formula | C23H26N2O13S |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-imidazol-1-ylsulfonyloxyphenoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccccc2OS(=O)(=O)n2ccnc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C23H26N2O13S/c1-13(26)32-11-19-20(33-14(2)27)21(34-15(3)28)22(35-16(4)29)23(37-19)36-17-7-5-6-8-18(17)38-39(30,31)25-10-9-24-12-25/h5-10,12,19-23H,11H2,1-4H3/t19-,20+,21+,22-,23-/m1/s1 |
| InChIKey | QSJHLENDIQTSRV-BMXMUORJSA-N |
| XLogP | 0.52 |
| TPSA | 184.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|