C18H15NO2S2 — CID 137404219
2-[(E)-2-methyl-3-(3-oxoprop-1-en-2-ylsulfanyl)prop-2-enoxy]-4-phenylthiophene-3-carbonitrile (PubChem CID 137404219) has the molecular formula C18H15NO2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-[(E)-2-methyl-3-(3-oxoprop-1-en-2-ylsulfanyl)prop-2-enoxy]-4-phenylthiophene-3-carbonitrile.
| Compound Name | 2-[(E)-2-methyl-3-(3-oxoprop-1-en-2-ylsulfanyl)prop-2-enoxy]-4-phenylthiophene-3-carbonitrile |
|---|---|
| PubChem CID | 137404219 |
| Molecular Formula | C18H15NO2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[(E)-2-methyl-3-(3-oxoprop-1-en-2-ylsulfanyl)prop-2-enoxy]-4-phenylthiophene-3-carbonitrile |
| SMILES | C=C(C=O)S/C=C(\C)COc1scc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C18H15NO2S2/c1-13(11-22-14(2)9-20)10-21-18-16(8-19)17(12-23-18)15-6-4-3-5-7-15/h3-7,9,11-12H,2,10H2,1H3/b13-11+ |
| InChIKey | CZWBAABFALWDLU-ACCUITESSA-N |
| XLogP | 5.02 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|