About butanedioic acid;(E)-1-chlorooct-1-ene
butanedioic acid;(E)-1-chlorooct-1-ene (PubChem CID 137404768) has the molecular formula C12H21ClO4
and a molecular weight of 264.75 g/mol. Its IUPAC name is butanedioic acid;(E)-1-chlorooct-1-ene.
Molecular Properties
| Compound Name | butanedioic acid;(E)-1-chlorooct-1-ene |
| PubChem CID | 137404768 |
| Molecular Formula | C12H21ClO4 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | butanedioic acid;(E)-1-chlorooct-1-ene |
| SMILES | CCCCCC/C=C/Cl.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C8H15Cl.C4H6O4/c1-2-3-4-5-6-7-8-9;5-3(6)1-2-4(7)8/h7-8H,2-6H2,1H3;1-2H2,(H,5,6)(H,7,8)/b8-7+; |
| InChIKey | PMLLFRCCAHQUKU-USRGLUTNSA-N |
| XLogP | 3.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;(E)-1-chlorooct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;(E)-1-chlorooct-1-ene?
The IUPAC name of butanedioic acid;(E)-1-chlorooct-1-ene (CID 137404768) is butanedioic acid;(E)-1-chlorooct-1-ene.
What is the SMILES notation for butanedioic acid;(E)-1-chlorooct-1-ene?
The canonical SMILES for butanedioic acid;(E)-1-chlorooct-1-ene is CCCCCC/C=C/Cl.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;(E)-1-chlorooct-1-ene?
The InChIKey is PMLLFRCCAHQUKU-USRGLUTNSA-N. The full InChI is InChI=1S/C8H15Cl.C4H6O4/c1-2-3-4-5-6-7-8-9;5-3(6)1-2-4(7)8/h7-8H,2-6H2,1H3;1-2H2,(H,5,6)(H,7,8)/b8-7+;.
What are the key properties of butanedioic acid;(E)-1-chlorooct-1-ene?
butanedioic acid;(E)-1-chlorooct-1-ene has a molecular weight of 264.75 g/mol, XLogP of 3.65, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;(E)-1-chlorooct-1-ene is sourced from PubChem (CID 137404768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).