C8H14N4O3 — CID 137407958
(2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-amine (PubChem CID 137407958) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is (2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-amine.
| Compound Name | (2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-amine |
|---|---|
| PubChem CID | 137407958 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-amine |
| SMILES | Cc1[nH]nc(OCC[C@@H](C)N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N4O3/c1-5(9)3-4-15-8-7(12(13)14)6(2)10-11-8/h5H,3-4,9H2,1-2H3,(H,10,11)/t5-/m1/s1 |
| InChIKey | KGACBBGLAXYJJE-RXMQYKEDSA-N |
| XLogP | 0.74 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|