C12H14Cl2N6O3 — CID 151678293
2,5-dichloro-N-[(2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-yl]pyrimidin-4-amine (PubChem CID 151678293) has the molecular formula C12H14Cl2N6O3 and a molecular weight of 361.19 g/mol. Its IUPAC name is 2,5-dichloro-N-[(2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-yl]pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-[(2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 151678293 |
| Molecular Formula | C12H14Cl2N6O3 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2,5-dichloro-N-[(2R)-4-[(5-methyl-4-nitro-1H-pyrazol-3-yl)oxy]butan-2-yl]pyrimidin-4-amine |
| SMILES | Cc1[nH]nc(OCC[C@@H](C)Nc2nc(Cl)ncc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14Cl2N6O3/c1-6(16-10-8(13)5-15-12(14)17-10)3-4-23-11-9(20(21)22)7(2)18-19-11/h5-6H,3-4H2,1-2H3,(H,18,19)(H,15,16,17)/t6-/m1/s1 |
| InChIKey | QZZIYBMRUDGRGF-ZCFIWIBFSA-N |
| XLogP | 2.99 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|