C8H14N6O — CID 137415029
(2S,4S)-1-methyl-4-(triazol-1-yl)pyrrolidine-2-carbohydrazide (PubChem CID 137415029) has the molecular formula C8H14N6O and a molecular weight of 210.24 g/mol. Its IUPAC name is (2S,4S)-1-methyl-4-(triazol-1-yl)pyrrolidine-2-carbohydrazide.
| Compound Name | (2S,4S)-1-methyl-4-(triazol-1-yl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 137415029 |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (2S,4S)-1-methyl-4-(triazol-1-yl)pyrrolidine-2-carbohydrazide |
| SMILES | CN1C[C@@H](n2ccnn2)C[C@H]1C(=O)NN |
| InChI | InChI=1S/C8H14N6O/c1-13-5-6(14-3-2-10-12-14)4-7(13)8(15)11-9/h2-3,6-7H,4-5,9H2,1H3,(H,11,15)/t6-,7-/m0/s1 |
| InChIKey | LKUJOYUAHWEDRU-BQBZGAKWSA-N |
| XLogP | -1.49 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|