C12H13N5O2S — CID 166265181
N'-[3-(triazol-1-yl)cyclobutanecarbonyl]thiophene-2-carbohydrazide (PubChem CID 166265181) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is N'-[3-(triazol-1-yl)cyclobutanecarbonyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[3-(triazol-1-yl)cyclobutanecarbonyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 166265181 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N'-[3-(triazol-1-yl)cyclobutanecarbonyl]thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC(n2ccnn2)C1)c1cccs1 |
| InChI | InChI=1S/C12H13N5O2S/c18-11(14-15-12(19)10-2-1-5-20-10)8-6-9(7-8)17-4-3-13-16-17/h1-5,8-9H,6-7H2,(H,14,18)(H,15,19) |
| InChIKey | JAYQGAVVCDEEHX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|