C23H35N7O5S — CID 137415433
2-amino-N-[4-[[1-[4-(4-aminopiperidin-1-yl)butyl]-2-oxopyrimidin-4-yl]sulfamoyl]phenyl]-3-hydroxy-2-methylpropanamide (PubChem CID 137415433) has the molecular formula C23H35N7O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-amino-N-[4-[[1-[4-(4-aminopiperidin-1-yl)butyl]-2-oxopyrimidin-4-yl]sulfamoyl]phenyl]-3-hydroxy-2-methylpropanamide.
| Compound Name | 2-amino-N-[4-[[1-[4-(4-aminopiperidin-1-yl)butyl]-2-oxopyrimidin-4-yl]sulfamoyl]phenyl]-3-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 137415433 |
| Molecular Formula | C23H35N7O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 2-amino-N-[4-[[1-[4-(4-aminopiperidin-1-yl)butyl]-2-oxopyrimidin-4-yl]sulfamoyl]phenyl]-3-hydroxy-2-methylpropanamide |
| SMILES | CC(N)(CO)C(=O)Nc1ccc(S(=O)(=O)Nc2ccn(CCCCN3CCC(N)CC3)c(=O)n2)cc1 |
| InChI | InChI=1S/C23H35N7O5S/c1-23(25,16-31)21(32)26-18-4-6-19(7-5-18)36(34,35)28-20-10-15-30(22(33)27-20)12-3-2-11-29-13-8-17(24)9-14-29/h4-7,10,15,17,31H,2-3,8-9,11-14,16,24-25H2,1H3,(H,26,32)(H,27,28,33) |
| InChIKey | MEJXQIADVHNCPW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 185.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|