C15H16N4O4S — CID 86734626
N-[4-[(1-cyclopropyl-2-oxopyrimidin-4-yl)sulfamoyl]phenyl]acetamide (PubChem CID 86734626) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is N-[4-[(1-cyclopropyl-2-oxopyrimidin-4-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(1-cyclopropyl-2-oxopyrimidin-4-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 86734626 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[4-[(1-cyclopropyl-2-oxopyrimidin-4-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccn(C3CC3)c(=O)n2)cc1 |
| InChI | InChI=1S/C15H16N4O4S/c1-10(20)16-11-2-6-13(7-3-11)24(22,23)18-14-8-9-19(12-4-5-12)15(21)17-14/h2-3,6-9,12H,4-5H2,1H3,(H,16,20)(H,17,18,21) |
| InChIKey | WGLAQCOYPXHGLA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |