C19H24ClN5O5 — CID 137415160
4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]-N-[1-[2-(2-chloroethoxy)ethyl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 137415160) has the molecular formula C19H24ClN5O5 and a molecular weight of 437.88 g/mol. Its IUPAC name is 4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]-N-[1-[2-(2-chloroethoxy)ethyl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | 4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]-N-[1-[2-(2-chloroethoxy)ethyl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 137415160 |
| Molecular Formula | C19H24ClN5O5 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[(2-amino-3-hydroxy-2-methylpropanoyl)amino]-N-[1-[2-(2-chloroethoxy)ethyl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC(N)(CO)C(=O)Nc1ccc(C(=O)Nc2ccn(CCOCCCl)c(=O)n2)cc1 |
| InChI | InChI=1S/C19H24ClN5O5/c1-19(21,12-26)17(28)22-14-4-2-13(3-5-14)16(27)23-15-6-8-25(18(29)24-15)9-11-30-10-7-20/h2-6,8,26H,7,9-12,21H2,1H3,(H,22,28)(H,23,24,27,29) |
| InChIKey | DTUGPSXGLBBMGV-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 148.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|