C21H24ClF2N5O3 — CID 137415997
5-chloro-2-[4-(2,2-difluoroethyl)piperazine-1-carbonyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137415997) has the molecular formula C21H24ClF2N5O3 and a molecular weight of 467.90 g/mol. Its IUPAC name is 5-chloro-2-[4-(2,2-difluoroethyl)piperazine-1-carbonyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[4-(2,2-difluoroethyl)piperazine-1-carbonyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137415997 |
| Molecular Formula | C21H24ClF2N5O3 |
| Molecular Weight | 467.90 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 5-chloro-2-[4-(2,2-difluoroethyl)piperazine-1-carbonyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | O=C1Nc2c(Cl)cc3nc(C(=O)N4CCN(CC(F)F)CC4)oc3c2C2(CCCCC2)N1 |
| InChI | InChI=1S/C21H24ClF2N5O3/c22-12-10-13-17(15-16(12)26-20(31)27-21(15)4-2-1-3-5-21)32-18(25-13)19(30)29-8-6-28(7-9-29)11-14(23)24/h10,14H,1-9,11H2,(H2,26,27,31) |
| InChIKey | FXUHNPVUBJAIPV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |