C11H14ClNO4S2 — CID 137417792
5-chloro-N-[2-(oxan-4-yl)-2-oxoethyl]thiophene-2-sulfonamide (PubChem CID 137417792) has the molecular formula C11H14ClNO4S2 and a molecular weight of 323.82 g/mol. Its IUPAC name is 5-chloro-N-[2-(oxan-4-yl)-2-oxoethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(oxan-4-yl)-2-oxoethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 137417792 |
| Molecular Formula | C11H14ClNO4S2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 5-chloro-N-[2-(oxan-4-yl)-2-oxoethyl]thiophene-2-sulfonamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)s1)C1CCOCC1 |
| InChI | InChI=1S/C11H14ClNO4S2/c12-10-1-2-11(18-10)19(15,16)13-7-9(14)8-3-5-17-6-4-8/h1-2,8,13H,3-7H2 |
| InChIKey | GLSTVIYROJMSPF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |