C13H17ClN6O2 — CID 137418432
(11R)-14-chloro-4-(methoxymethyl)-11-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 137418432) has the molecular formula C13H17ClN6O2 and a molecular weight of 324.77 g/mol. Its IUPAC name is (11R)-14-chloro-4-(methoxymethyl)-11-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | (11R)-14-chloro-4-(methoxymethyl)-11-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 137418432 |
| Molecular Formula | C13H17ClN6O2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (11R)-14-chloro-4-(methoxymethyl)-11-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | COCc1[nH]nc2c1Nc1ncc(Cl)c(n1)N[C@H](C)CCO2 |
| InChI | InChI=1S/C13H17ClN6O2/c1-7-3-4-22-12-10(9(6-21-2)19-20-12)17-13-15-5-8(14)11(16-7)18-13/h5,7H,3-4,6H2,1-2H3,(H,19,20)(H2,15,16,17,18)/t7-/m1/s1 |
| InChIKey | JGHNQNILXZDUFU-SSDOTTSWSA-N |
| XLogP | 2.33 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |