C18H23ClN6O2 — CID 137418578
4-(14-chloro-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaen-5-yl)cyclohexan-1-one (PubChem CID 137418578) has the molecular formula C18H23ClN6O2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 4-(14-chloro-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaen-5-yl)cyclohexan-1-one.
| Compound Name | 4-(14-chloro-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaen-5-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 137418578 |
| Molecular Formula | C18H23ClN6O2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-(14-chloro-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaen-5-yl)cyclohexan-1-one |
| SMILES | Cc1c2c(nn1C1CCC(=O)CC1)OCCC(C)Nc1nc(ncc1Cl)N2 |
| InChI | InChI=1S/C18H23ClN6O2/c1-10-7-8-27-17-15(22-18-20-9-14(19)16(21-10)23-18)11(2)25(24-17)12-3-5-13(26)6-4-12/h9-10,12H,3-8H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | ZPKUZZCHQJRPQZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |