C17H23ClFN7O — CID 155387104
(11R)-14-chloro-5-(3-fluoropiperidin-4-yl)-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 155387104) has the molecular formula C17H23ClFN7O and a molecular weight of 395.87 g/mol. Its IUPAC name is (11R)-14-chloro-5-(3-fluoropiperidin-4-yl)-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | (11R)-14-chloro-5-(3-fluoropiperidin-4-yl)-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 155387104 |
| Molecular Formula | C17H23ClFN7O |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (11R)-14-chloro-5-(3-fluoropiperidin-4-yl)-4,11-dimethyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | Cc1c2c(nn1C1CCNCC1F)OCC[C@@H](C)Nc1nc(ncc1Cl)N2 |
| InChI | InChI=1S/C17H23ClFN7O/c1-9-4-6-27-16-14(23-17-21-7-11(18)15(22-9)24-17)10(2)26(25-16)13-3-5-20-8-12(13)19/h7,9,12-13,20H,3-6,8H2,1-2H3,(H2,21,22,23,24)/t9-,12?,13?/m1/s1 |
| InChIKey | OPTNHBVHWOMEHP-UHEGKEBESA-N |
| XLogP | 2.83 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |