C16H19ClF2N6O2 — CID 155649502
14-chloro-5-[(4R)-3,3-difluorooxan-4-yl]-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 155649502) has the molecular formula C16H19ClF2N6O2 and a molecular weight of 400.82 g/mol. Its IUPAC name is 14-chloro-5-[(4R)-3,3-difluorooxan-4-yl]-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | 14-chloro-5-[(4R)-3,3-difluorooxan-4-yl]-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 155649502 |
| Molecular Formula | C16H19ClF2N6O2 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 14-chloro-5-[(4R)-3,3-difluorooxan-4-yl]-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | Cc1c2c(nn1[C@@H]1CCOCC1(F)F)OCCCNc1nc(ncc1Cl)N2 |
| InChI | InChI=1S/C16H19ClF2N6O2/c1-9-12-14(24-25(9)11-3-6-26-8-16(11,18)19)27-5-2-4-20-13-10(17)7-21-15(22-12)23-13/h7,11H,2-6,8H2,1H3,(H2,20,21,22,23)/t11-/m1/s1 |
| InChIKey | LGSNBMPNLRQMSY-LLVKDONJSA-N |
| XLogP | 3.17 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |