C17H21ClF2N6O3 — CID 155397880
14-chloro-10-(difluoromethoxy)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 155397880) has the molecular formula C17H21ClF2N6O3 and a molecular weight of 430.84 g/mol. Its IUPAC name is 14-chloro-10-(difluoromethoxy)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | 14-chloro-10-(difluoromethoxy)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 155397880 |
| Molecular Formula | C17H21ClF2N6O3 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 14-chloro-10-(difluoromethoxy)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | Cc1c2c(nn1C1CCOCC1)OCC(OC(F)F)CNc1nc(ncc1Cl)N2 |
| InChI | InChI=1S/C17H21ClF2N6O3/c1-9-13-15(25-26(9)10-2-4-27-5-3-10)28-8-11(29-16(19)20)6-21-14-12(18)7-22-17(23-13)24-14/h7,10-11,16H,2-6,8H2,1H3,(H2,21,22,23,24) |
| InChIKey | PEXIILPBJFJZRX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |