C18H25ClEs2N6O2 — CID 142515107
14-chloro-4-methyl-5-[1-(oxan-4-yl)ethyl]-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene;einsteinium (PubChem CID 142515107) has the molecular formula C18H25ClEs2N6O2 and a molecular weight of 896.89 g/mol. Its IUPAC name is 14-chloro-4-methyl-5-[1-(oxan-4-yl)ethyl]-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene;einsteinium.
| Compound Name | 14-chloro-4-methyl-5-[1-(oxan-4-yl)ethyl]-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene;einsteinium |
|---|---|
| PubChem CID | 142515107 |
| Molecular Formula | C18H25ClEs2N6O2 |
| Molecular Weight | 896.89 g/mol |
| Exact Mass | 896.34 |
| IUPAC Name | 14-chloro-4-methyl-5-[1-(oxan-4-yl)ethyl]-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene;einsteinium |
| SMILES | Cc1c2c(nn1C(C)C1CCOCC1)OCCCNc1nc(ncc1Cl)N2.[Es].[Es] |
| InChI | InChI=1S/C18H25ClN6O2.2Es/c1-11(13-4-8-26-9-5-13)25-12(2)15-17(24-25)27-7-3-6-20-16-14(19)10-21-18(22-15)23-16;;/h10-11,13H,3-9H2,1-2H3,(H2,20,21,22,23);; |
| InChIKey | GGQBYOYKKURJBJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |