C18H19ClN6O2 — CID 137418618
14-chloro-5-(3-methoxyphenyl)-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 137418618) has the molecular formula C18H19ClN6O2 and a molecular weight of 386.84 g/mol. Its IUPAC name is 14-chloro-5-(3-methoxyphenyl)-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | 14-chloro-5-(3-methoxyphenyl)-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 137418618 |
| Molecular Formula | C18H19ClN6O2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 14-chloro-5-(3-methoxyphenyl)-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | COc1cccc(-n2nc3c(c2C)Nc2ncc(Cl)c(n2)NCCCO3)c1 |
| InChI | InChI=1S/C18H19ClN6O2/c1-11-15-17(24-25(11)12-5-3-6-13(9-12)26-2)27-8-4-7-20-16-14(19)10-21-18(22-15)23-16/h3,5-6,9-10H,4,7-8H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | FCGQHVYTHMNRFY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |