C11H12ClIN4 — CID 137419989
N-butyl-5-chloro-8-iodopyrido[4,3-d]pyrimidin-2-amine (PubChem CID 137419989) has the molecular formula C11H12ClIN4 and a molecular weight of 362.60 g/mol. Its IUPAC name is N-butyl-5-chloro-8-iodopyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | N-butyl-5-chloro-8-iodopyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137419989 |
| Molecular Formula | C11H12ClIN4 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | N-butyl-5-chloro-8-iodopyrido[4,3-d]pyrimidin-2-amine |
| SMILES | CCCCNc1ncc2c(Cl)ncc(I)c2n1 |
| InChI | InChI=1S/C11H12ClIN4/c1-2-3-4-14-11-16-5-7-9(17-11)8(13)6-15-10(7)12/h5-6H,2-4H2,1H3,(H,14,16,17) |
| InChIKey | QHPFFLSCQBESCQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|