C9H15F3 — CID 137420305
(3S)-6,6,6-trifluoro-3-propan-2-ylhex-1-ene (PubChem CID 137420305) has the molecular formula C9H15F3 and a molecular weight of 180.21 g/mol. Its IUPAC name is (3S)-6,6,6-trifluoro-3-propan-2-ylhex-1-ene.
| Compound Name | (3S)-6,6,6-trifluoro-3-propan-2-ylhex-1-ene |
|---|---|
| PubChem CID | 137420305 |
| Molecular Formula | C9H15F3 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | (3S)-6,6,6-trifluoro-3-propan-2-ylhex-1-ene |
| SMILES | C=C[C@@H](CCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H15F3/c1-4-8(7(2)3)5-6-9(10,11)12/h4,7-8H,1,5-6H2,2-3H3/t8-/m0/s1 |
| InChIKey | KXPJRJUQWXMXPM-QMMMGPOBSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|