C26H30FN5O6S2 — CID 137422189
tert-butyl 5-[[4-[(4-amino-4-iminobutanoyl)amino]-3-fluorophenyl]sulfonyl-[(4-methoxyphenyl)methyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 137422189) has the molecular formula C26H30FN5O6S2 and a molecular weight of 591.69 g/mol. Its IUPAC name is tert-butyl 5-[[4-[(4-amino-4-iminobutanoyl)amino]-3-fluorophenyl]sulfonyl-[(4-methoxyphenyl)methyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 5-[[4-[(4-amino-4-iminobutanoyl)amino]-3-fluorophenyl]sulfonyl-[(4-methoxyphenyl)methyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 137422189 |
| Molecular Formula | C26H30FN5O6S2 |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | tert-butyl 5-[[4-[(4-amino-4-iminobutanoyl)amino]-3-fluorophenyl]sulfonyl-[(4-methoxyphenyl)methyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | [H]/N=C(\N)CCC(=O)Nc1ccc(S(=O)(=O)N(Cc2ccc(OC)cc2)c2scnc2C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C26H30FN5O6S2/c1-26(2,3)38-25(34)23-24(39-15-30-23)32(14-16-5-7-17(37-4)8-6-16)40(35,36)18-9-10-20(19(27)13-18)31-22(33)12-11-21(28)29/h5-10,13,15H,11-12,14H2,1-4H3,(H3,28,29)(H,31,33) |
| InChIKey | QDPCFPAKQAVETJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 164.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|