C18H22ClFN3O5PS2 — CID 155244915
tert-butyl 5-[[4-(3-chloropropanoylamino)-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate (PubChem CID 155244915) has the molecular formula C18H22ClFN3O5PS2 and a molecular weight of 509.95 g/mol. Its IUPAC name is tert-butyl 5-[[4-(3-chloropropanoylamino)-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 5-[[4-(3-chloropropanoylamino)-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155244915 |
| Molecular Formula | C18H22ClFN3O5PS2 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | tert-butyl 5-[[4-(3-chloropropanoylamino)-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CPN(c1scnc1C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(NC(=O)CCCl)c(F)c1 |
| InChI | InChI=1S/C18H22ClFN3O5PS2/c1-18(2,3)28-17(25)15-16(30-10-21-15)23(29-4)31(26,27)11-5-6-13(12(20)9-11)22-14(24)7-8-19/h5-6,9-10,29H,7-8H2,1-4H3,(H,22,24) |
| InChIKey | KKIBSJASRVZOLT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|