C22H30FN6O6PS2 — CID 155244899
tert-butyl 5-[[4-[[2-[[amino(morpholin-4-yl)methylidene]amino]acetyl]amino]-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate (PubChem CID 155244899) has the molecular formula C22H30FN6O6PS2 and a molecular weight of 588.62 g/mol. Its IUPAC name is tert-butyl 5-[[4-[[2-[[amino(morpholin-4-yl)methylidene]amino]acetyl]amino]-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 5-[[4-[[2-[[amino(morpholin-4-yl)methylidene]amino]acetyl]amino]-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155244899 |
| Molecular Formula | C22H30FN6O6PS2 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | tert-butyl 5-[[4-[[2-[[amino(morpholin-4-yl)methylidene]amino]acetyl]amino]-3-fluorophenyl]sulfonyl-methylphosphanylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CPN(c1scnc1C(=O)OC(C)(C)C)S(=O)(=O)c1ccc(NC(=O)C/N=C(\N)N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C22H30FN6O6PS2/c1-22(2,3)35-20(31)18-19(37-13-26-18)29(36-4)38(32,33)14-5-6-16(15(23)11-14)27-17(30)12-25-21(24)28-7-9-34-10-8-28/h5-6,11,13,36H,7-10,12H2,1-4H3,(H2,24,25)(H,27,30) |
| InChIKey | UFRSCLZNWYRCAY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 156.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|