C13H13FN6O5S2 — CID 137422185
5-[[4-[(2-amino-2-iminoethyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 137422185) has the molecular formula C13H13FN6O5S2 and a molecular weight of 416.42 g/mol. Its IUPAC name is 5-[[4-[(2-amino-2-iminoethyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[[4-[(2-amino-2-iminoethyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 137422185 |
| Molecular Formula | C13H13FN6O5S2 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 5-[[4-[(2-amino-2-iminoethyl)carbamoylamino]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | [H]/N=C(\N)CNC(=O)Nc1ccc(S(=O)(=O)Nc2scnc2C(=O)O)cc1F |
| InChI | InChI=1S/C13H13FN6O5S2/c14-7-3-6(1-2-8(7)19-13(23)17-4-9(15)16)27(24,25)20-11-10(12(21)22)18-5-26-11/h1-3,5,20H,4H2,(H3,15,16)(H,21,22)(H2,17,19,23) |
| InChIKey | VTDJKJCHVAVTDE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 187.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|