C13H15FN6O3S3 — CID 175903983
S-[2-(diaminomethylideneamino)ethyl] N-[2-fluoro-4-(1,3-thiazol-5-ylsulfamoyl)phenyl]carbamothioate (PubChem CID 175903983) has the molecular formula C13H15FN6O3S3 and a molecular weight of 418.50 g/mol. Its IUPAC name is S-[2-(diaminomethylideneamino)ethyl] N-[2-fluoro-4-(1,3-thiazol-5-ylsulfamoyl)phenyl]carbamothioate.
| Compound Name | S-[2-(diaminomethylideneamino)ethyl] N-[2-fluoro-4-(1,3-thiazol-5-ylsulfamoyl)phenyl]carbamothioate |
|---|---|
| PubChem CID | 175903983 |
| Molecular Formula | C13H15FN6O3S3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | S-[2-(diaminomethylideneamino)ethyl] N-[2-fluoro-4-(1,3-thiazol-5-ylsulfamoyl)phenyl]carbamothioate |
| SMILES | NC(N)=NCCSC(=O)Nc1ccc(S(=O)(=O)Nc2cncs2)cc1F |
| InChI | InChI=1S/C13H15FN6O3S3/c14-9-5-8(26(22,23)20-11-6-17-7-25-11)1-2-10(9)19-13(21)24-4-3-18-12(15)16/h1-2,5-7,20H,3-4H2,(H,19,21)(H4,15,16,18) |
| InChIKey | WENYAPGWBAZCEE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|