C11H10FN5O5S2 — CID 137428998
5-[[3-fluoro-4-(hydrazinecarbonylamino)phenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 137428998) has the molecular formula C11H10FN5O5S2 and a molecular weight of 375.36 g/mol. Its IUPAC name is 5-[[3-fluoro-4-(hydrazinecarbonylamino)phenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[[3-fluoro-4-(hydrazinecarbonylamino)phenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 137428998 |
| Molecular Formula | C11H10FN5O5S2 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 5-[[3-fluoro-4-(hydrazinecarbonylamino)phenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | NNC(=O)Nc1ccc(S(=O)(=O)Nc2scnc2C(=O)O)cc1F |
| InChI | InChI=1S/C11H10FN5O5S2/c12-6-3-5(1-2-7(6)15-11(20)16-13)24(21,22)17-9-8(10(18)19)14-4-23-9/h1-4,17H,13H2,(H,18,19)(H2,15,16,20) |
| InChIKey | XHBYVOIXBYEPDH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|