C15H16FN5O5S2 — CID 161415854
5-[[4-[3-[(2-amino-2-iminoethyl)amino]-2-oxopropyl]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 161415854) has the molecular formula C15H16FN5O5S2 and a molecular weight of 429.46 g/mol. Its IUPAC name is 5-[[4-[3-[(2-amino-2-iminoethyl)amino]-2-oxopropyl]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[[4-[3-[(2-amino-2-iminoethyl)amino]-2-oxopropyl]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 161415854 |
| Molecular Formula | C15H16FN5O5S2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 5-[[4-[3-[(2-amino-2-iminoethyl)amino]-2-oxopropyl]-3-fluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | [H]/N=C(\N)CNCC(=O)Cc1ccc(S(=O)(=O)Nc2scnc2C(=O)O)cc1F |
| InChI | InChI=1S/C15H16FN5O5S2/c16-11-4-10(2-1-8(11)3-9(22)5-19-6-12(17)18)28(25,26)21-14-13(15(23)24)20-7-27-14/h1-2,4,7,19,21H,3,5-6H2,(H3,17,18)(H,23,24) |
| InChIKey | VWBPJQFYKJNCKO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 175.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|