C18H19F2N8O5S2+ — CID 151116114
5-[[4-[[2-[3-[2-(diaminomethylideneamino)ethyl]imidazol-1-ium-1-yl]acetyl]amino]-3,5-difluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 151116114) has the molecular formula C18H19F2N8O5S2+ and a molecular weight of 529.53 g/mol. Its IUPAC name is 5-[[4-[[2-[3-[2-(diaminomethylideneamino)ethyl]imidazol-1-ium-1-yl]acetyl]amino]-3,5-difluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-[[4-[[2-[3-[2-(diaminomethylideneamino)ethyl]imidazol-1-ium-1-yl]acetyl]amino]-3,5-difluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 151116114 |
| Molecular Formula | C18H19F2N8O5S2+ |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 5-[[4-[[2-[3-[2-(diaminomethylideneamino)ethyl]imidazol-1-ium-1-yl]acetyl]amino]-3,5-difluorophenyl]sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | NC(N)=NCCn1cc[n+](CC(=O)Nc2c(F)cc(S(=O)(=O)Nc3scnc3C(=O)O)cc2F)c1 |
| InChI | InChI=1S/C18H18F2N8O5S2/c19-11-5-10(35(32,33)26-16-15(17(30)31)24-8-34-16)6-12(20)14(11)25-13(29)7-28-4-3-27(9-28)2-1-23-18(21)22/h3-6,8-9,26H,1-2,7H2,(H5-,21,22,23,25,29,30,31)/p+1 |
| InChIKey | MREIPSMNXGNVII-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 198.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|