C13H17NO — CID 137428981
spiro[1,7-dihydrocyclohepta[c]furan-3,4'-piperidine] (PubChem CID 137428981) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is spiro[1,7-dihydrocyclohepta[c]furan-3,4'-piperidine].
| Compound Name | spiro[1,7-dihydrocyclohepta[c]furan-3,4'-piperidine] |
|---|---|
| PubChem CID | 137428981 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | spiro[1,7-dihydrocyclohepta[c]furan-3,4'-piperidine] |
| SMILES | C1=CCC=C2COC3(CCNCC3)C2=C1 |
| InChI | InChI=1S/C13H17NO/c1-2-4-11-10-15-13(12(11)5-3-1)6-8-14-9-7-13/h1,3-5,14H,2,6-10H2 |
| InChIKey | QCAOSEBJLGYTBW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |