C12H17NO — CID 143635779
spiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] (PubChem CID 143635779) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is spiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine].
| Compound Name | spiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 143635779 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | spiro[3a,7a-dihydro-1H-2-benzofuran-3,4'-piperidine] |
| SMILES | C1=CC2COC3(CCNCC3)C2C=C1 |
| InChI | InChI=1S/C12H17NO/c1-2-4-11-10(3-1)9-14-12(11)5-7-13-8-6-12/h1-4,10-11,13H,5-9H2 |
| InChIKey | JPDIBOBJSIWTLB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |