C9H10N2O2 — CID 137429134
3-hydroxy-2-methyl-3H-pyrido[1,2-c]pyrimidin-1-one (PubChem CID 137429134) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-hydroxy-2-methyl-3H-pyrido[1,2-c]pyrimidin-1-one.
| Compound Name | 3-hydroxy-2-methyl-3H-pyrido[1,2-c]pyrimidin-1-one |
|---|---|
| PubChem CID | 137429134 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3-hydroxy-2-methyl-3H-pyrido[1,2-c]pyrimidin-1-one |
| SMILES | CN1C(=O)N2C=CC=CC2=CC1O |
| InChI | InChI=1S/C9H10N2O2/c1-10-8(12)6-7-4-2-3-5-11(7)9(10)13/h2-6,8,12H,1H3 |
| InChIKey | DVVQACPKPHXZJW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |