About quinolizino[4,3-c]quinolizine
quinolizino[4,3-c]quinolizine (PubChem CID 53254646) has the molecular formula C16H12N2
and a molecular weight of 232.29 g/mol. Its IUPAC name is quinolizino[4,3-c]quinolizine.
Molecular Properties
| Compound Name | quinolizino[4,3-c]quinolizine |
| PubChem CID | 53254646 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | quinolizino[4,3-c]quinolizine |
| SMILES | C1=CC2=CC=C3C(=CC=C4C=CC=CN43)N2C=C1 |
| InChI | InChI=1S/C16H12N2/c1-3-11-17-13(5-1)7-9-16-15(17)10-8-14-6-2-4-12-18(14)16/h1-12H |
| InChIKey | OTOUMXOKTMSTPS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolizino[4,3-c]quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolizino[4,3-c]quinolizine?
The IUPAC name of quinolizino[4,3-c]quinolizine (CID 53254646) is quinolizino[4,3-c]quinolizine.
What is the SMILES notation for quinolizino[4,3-c]quinolizine?
The canonical SMILES for quinolizino[4,3-c]quinolizine is C1=CC2=CC=C3C(=CC=C4C=CC=CN43)N2C=C1.
What is the InChIKey of quinolizino[4,3-c]quinolizine?
The InChIKey is OTOUMXOKTMSTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2/c1-3-11-17-13(5-1)7-9-16-15(17)10-8-14-6-2-4-12-18(14)16/h1-12H.
What are the key properties of quinolizino[4,3-c]quinolizine?
quinolizino[4,3-c]quinolizine has a molecular weight of 232.29 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolizino[4,3-c]quinolizine is sourced from PubChem (CID 53254646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).