C25H22ClN5OS — CID 137429470
6-(2-chlorophenyl)-N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 137429470) has the molecular formula C25H22ClN5OS and a molecular weight of 476.01 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(2-chlorophenyl)-N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137429470 |
| Molecular Formula | C25H22ClN5OS |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 6-(2-chlorophenyl)-N-(2-methoxyethyl)-2-(1-methylimidazol-2-yl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCNc1nc(-c2nccn2C)nc2sc(-c3ccccc3Cl)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C25H22ClN5OS/c1-31-14-12-28-24(31)23-29-22(27-13-15-32-2)20-19(16-8-4-3-5-9-16)21(33-25(20)30-23)17-10-6-7-11-18(17)26/h3-12,14H,13,15H2,1-2H3,(H,27,29,30) |
| InChIKey | RPOZFPRMXQTADH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|