C23H20N6OS2 — CID 166559601
2-(1-methylimidazol-2-yl)-6-phenyl-5-pyridin-2-yl-N-(2-sulfanyloxyethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 166559601) has the molecular formula C23H20N6OS2 and a molecular weight of 460.59 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-6-phenyl-5-pyridin-2-yl-N-(2-sulfanyloxyethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(1-methylimidazol-2-yl)-6-phenyl-5-pyridin-2-yl-N-(2-sulfanyloxyethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166559601 |
| Molecular Formula | C23H20N6OS2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-6-phenyl-5-pyridin-2-yl-N-(2-sulfanyloxyethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cn1ccnc1-c1nc(NCCOS)c2c(-c3ccccn3)c(-c3ccccc3)sc2n1 |
| InChI | InChI=1S/C23H20N6OS2/c1-29-13-11-26-22(29)21-27-20(25-12-14-30-31)18-17(16-9-5-6-10-24-16)19(32-23(18)28-21)15-7-3-2-4-8-15/h2-11,13,31H,12,14H2,1H3,(H,25,27,28) |
| InChIKey | IVWZXFAKLNACNZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|