C26H25N5OS — CID 146396039
N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-6-(4-methylphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 146396039) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-6-(4-methylphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-6-(4-methylphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146396039 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-6-(4-methylphenyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCNc1nc(-c2cn(C)cn2)nc2sc(-c3ccc(C)cc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C26H25N5OS/c1-17-9-11-19(12-10-17)23-21(18-7-5-4-6-8-18)22-25(27-13-14-32-3)29-24(30-26(22)33-23)20-15-31(2)16-28-20/h4-12,15-16H,13-14H2,1-3H3,(H,27,29,30) |
| InChIKey | CIENVBXSPBSFRG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|