C21H27N3S — CID 137432066
6-methyl-2-pentan-2-yl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 137432066) has the molecular formula C21H27N3S and a molecular weight of 353.54 g/mol. Its IUPAC name is 6-methyl-2-pentan-2-yl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-2-pentan-2-yl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137432066 |
| Molecular Formula | C21H27N3S |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 6-methyl-2-pentan-2-yl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCC(C)c1nc(NCCCc2ccccc2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C21H27N3S/c1-4-9-15(2)19-23-20(18-14-16(3)25-21(18)24-19)22-13-8-12-17-10-6-5-7-11-17/h5-7,10-11,14-15H,4,8-9,12-13H2,1-3H3,(H,22,23,24) |
| InChIKey | RHXWXQXEVFWJQQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|