C18H21N3OS — CID 166119800
2-(methoxymethyl)-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 166119800) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(methoxymethyl)-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166119800 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(methoxymethyl)-6-methyl-N-(3-phenylpropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCc1nc(NCCCc2ccccc2)c2cc(C)sc2n1 |
| InChI | InChI=1S/C18H21N3OS/c1-13-11-15-17(20-16(12-22-2)21-18(15)23-13)19-10-6-9-14-7-4-3-5-8-14/h3-5,7-8,11H,6,9-10,12H2,1-2H3,(H,19,20,21) |
| InChIKey | YYRBBUYGNYPZJA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|