C14H17N3S — CID 166120028
2-ethyl-6-methyl-N-pent-4-ynylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 166120028) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-ethyl-6-methyl-N-pent-4-ynylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-ethyl-6-methyl-N-pent-4-ynylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166120028 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-ethyl-6-methyl-N-pent-4-ynylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C#CCCCNc1nc(CC)nc2sc(C)cc12 |
| InChI | InChI=1S/C14H17N3S/c1-4-6-7-8-15-13-11-9-10(3)18-14(11)17-12(5-2)16-13/h1,9H,5-8H2,2-3H3,(H,15,16,17) |
| InChIKey | FBIFSENRZFGFJV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|