C23H27N3O2 — CID 137447038
methyl 4-[[1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-yl]amino]benzoate (PubChem CID 137447038) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is methyl 4-[[1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 137447038 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | methyl 4-[[1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc3ccccc3n2[C@H]2CCCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-23(2)14-6-7-18(15-23)26-20-9-5-4-8-19(20)25-22(26)24-17-12-10-16(11-13-17)21(27)28-3/h4-5,8-13,18H,6-7,14-15H2,1-3H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | YHKRDCWDUVDFLF-SFHVURJKSA-N |
| XLogP | 5.71 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |